C12H15Cl2NS2 — CID 115762605
N-[(2,5-dichlorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine (PubChem CID 115762605) has the molecular formula C12H15Cl2NS2 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 115762605 |
| Molecular Formula | C12H15Cl2NS2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine |
| SMILES | Clc1ccc(Cl)c(CNCC2CSCCS2)c1 |
| InChI | InChI=1S/C12H15Cl2NS2/c13-10-1-2-12(14)9(5-10)6-15-7-11-8-16-3-4-17-11/h1-2,5,11,15H,3-4,6-8H2 |
| InChIKey | HXTOBTYUXCSSAP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |