C14H22N2S2 — CID 126813894
2-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-dimethylaniline (PubChem CID 126813894) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is 2-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-dimethylaniline.
| Compound Name | 2-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 126813894 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1CNCC1CSCCS1 |
| InChI | InChI=1S/C14H22N2S2/c1-16(2)14-6-4-3-5-12(14)9-15-10-13-11-17-7-8-18-13/h3-6,13,15H,7-11H2,1-2H3 |
| InChIKey | WZRXHJXIASYVPU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |