C10H15NOS2 — CID 115696098
1-(1,4-dithian-2-yl)-N-(furan-3-ylmethyl)methanamine (PubChem CID 115696098) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-(furan-3-ylmethyl)methanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-(furan-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 115696098 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-(furan-3-ylmethyl)methanamine |
| SMILES | c1cc(CNCC2CSCCS2)co1 |
| InChI | InChI=1S/C10H15NOS2/c1-2-12-7-9(1)5-11-6-10-8-13-3-4-14-10/h1-2,7,10-11H,3-6,8H2 |
| InChIKey | JKAAPVGWRVICNX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |