C10H16N2O2S4 — CID 126833104
5-[(1,4-dithian-2-ylmethylamino)methyl]thiophene-2-sulfonamide (PubChem CID 126833104) has the molecular formula C10H16N2O2S4 and a molecular weight of 324.52 g/mol. Its IUPAC name is 5-[(1,4-dithian-2-ylmethylamino)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-[(1,4-dithian-2-ylmethylamino)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126833104 |
| Molecular Formula | C10H16N2O2S4 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 5-[(1,4-dithian-2-ylmethylamino)methyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNCC2CSCCS2)s1 |
| InChI | InChI=1S/C10H16N2O2S4/c11-18(13,14)10-2-1-8(17-10)5-12-6-9-7-15-3-4-16-9/h1-2,9,12H,3-7H2,(H2,11,13,14) |
| InChIKey | CQGJIOPZADAEKW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |