C16H26N2S2 — CID 115696118
4-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-diethylaniline (PubChem CID 115696118) has the molecular formula C16H26N2S2 and a molecular weight of 310.53 g/mol. Its IUPAC name is 4-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-diethylaniline.
| Compound Name | 4-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 115696118 |
| Molecular Formula | C16H26N2S2 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[(1,4-dithian-2-ylmethylamino)methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CNCC2CSCCS2)cc1 |
| InChI | InChI=1S/C16H26N2S2/c1-3-18(4-2)15-7-5-14(6-8-15)11-17-12-16-13-19-9-10-20-16/h5-8,16-17H,3-4,9-13H2,1-2H3 |
| InChIKey | OGUCUYMLASRHQJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|