C14H18N2S2 — CID 102912029
1-(1,4-dithian-2-yl)-N-(1H-indol-5-ylmethyl)methanamine (PubChem CID 102912029) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-(1H-indol-5-ylmethyl)methanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-(1H-indol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 102912029 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-(1H-indol-5-ylmethyl)methanamine |
| SMILES | c1cc2cc(CNCC3CSCCS3)ccc2[nH]1 |
| InChI | InChI=1S/C14H18N2S2/c1-2-14-12(3-4-16-14)7-11(1)8-15-9-13-10-17-5-6-18-13/h1-4,7,13,15-16H,5-6,8-10H2 |
| InChIKey | WIEXWSVKDNIJBT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |