C12H14F3NS2 — CID 115696225
1-(1,4-dithian-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine (PubChem CID 115696225) has the molecular formula C12H14F3NS2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 115696225 |
| Molecular Formula | C12H14F3NS2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
| SMILES | Fc1cc(CNCC2CSCCS2)cc(F)c1F |
| InChI | InChI=1S/C12H14F3NS2/c13-10-3-8(4-11(14)12(10)15)5-16-6-9-7-17-1-2-18-9/h3-4,9,16H,1-2,5-7H2 |
| InChIKey | MSIMRMVJIWRTJH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|