C13H18ClNS2 — CID 113262624
1-(3-chlorophenyl)-N-(1,4-dithian-2-ylmethyl)ethanamine (PubChem CID 113262624) has the molecular formula C13H18ClNS2 and a molecular weight of 287.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(1,4-dithian-2-ylmethyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-(1,4-dithian-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 113262624 |
| Molecular Formula | C13H18ClNS2 |
| Molecular Weight | 287.88 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(1,4-dithian-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1CSCCS1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNS2/c1-10(11-3-2-4-12(14)7-11)15-8-13-9-16-5-6-17-13/h2-4,7,10,13,15H,5-6,8-9H2,1H3 |
| InChIKey | TWAXGRCALHROGX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |