C12H18N2S2 — CID 115886460
N-(1,4-dithian-2-ylmethyl)-1-pyridin-3-ylethanamine (PubChem CID 115886460) has the molecular formula C12H18N2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-pyridin-3-ylethanamine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 115886460 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-pyridin-3-ylethanamine |
| SMILES | CC(NCC1CSCCS1)c1cccnc1 |
| InChI | InChI=1S/C12H18N2S2/c1-10(11-3-2-4-13-7-11)14-8-12-9-15-5-6-16-12/h2-4,7,10,12,14H,5-6,8-9H2,1H3 |
| InChIKey | PVSWSJGFJKZGTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |