C14H20ClNS — CID 115625455
1-(3-chlorophenyl)-N-(thian-4-ylmethyl)ethanamine (PubChem CID 115625455) has the molecular formula C14H20ClNS and a molecular weight of 269.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(thian-4-ylmethyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-(thian-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115625455 |
| Molecular Formula | C14H20ClNS |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(thian-4-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCSCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClNS/c1-11(13-3-2-4-14(15)9-13)16-10-12-5-7-17-8-6-12/h2-4,9,11-12,16H,5-8,10H2,1H3 |
| InChIKey | XFROZGRLQQIDKI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |