C18H20ClN — CID 79978825
1-(3-chlorophenyl)-N-[(4-cyclopropylphenyl)methyl]ethanamine (PubChem CID 79978825) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(4-cyclopropylphenyl)methyl]ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-[(4-cyclopropylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 79978825 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(4-cyclopropylphenyl)methyl]ethanamine |
| SMILES | CC(NCc1ccc(C2CC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN/c1-13(17-3-2-4-18(19)11-17)20-12-14-5-7-15(8-6-14)16-9-10-16/h2-8,11,13,16,20H,9-10,12H2,1H3 |
| InChIKey | KAQOMAIRDFMPIU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |