C18H24ClNSi — CID 103437957
(1R)-1-(3-chlorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103437957) has the molecular formula C18H24ClNSi and a molecular weight of 317.94 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(3-chlorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103437957 |
| Molecular Formula | C18H24ClNSi |
| Molecular Weight | 317.94 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc([Si](C)(C)C)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H24ClNSi/c1-14(16-6-5-7-17(19)12-16)20-13-15-8-10-18(11-9-15)21(2,3)4/h5-12,14,20H,13H2,1-4H3/t14-/m1/s1 |
| InChIKey | IBTTXJAFJIFYNM-CQSZACIVSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.94 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|