C18H21NO — CID 79978926
3-[1-[(4-cyclopropylphenyl)methylamino]ethyl]phenol (PubChem CID 79978926) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[1-[(4-cyclopropylphenyl)methylamino]ethyl]phenol.
| Compound Name | 3-[1-[(4-cyclopropylphenyl)methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 79978926 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[1-[(4-cyclopropylphenyl)methylamino]ethyl]phenol |
| SMILES | CC(NCc1ccc(C2CC2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C18H21NO/c1-13(17-3-2-4-18(20)11-17)19-12-14-5-7-15(8-6-14)16-9-10-16/h2-8,11,13,16,19-20H,9-10,12H2,1H3 |
| InChIKey | HNMDSAYNROREQT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |