C10H8BrF2NO — CID 106944077
azetidin-3-yl-(3-bromo-2,6-difluorophenyl)methanone (PubChem CID 106944077) has the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. Its IUPAC name is azetidin-3-yl-(3-bromo-2,6-difluorophenyl)methanone.
| Compound Name | azetidin-3-yl-(3-bromo-2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 106944077 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | azetidin-3-yl-(3-bromo-2,6-difluorophenyl)methanone |
| SMILES | O=C(c1c(F)ccc(Br)c1F)C1CNC1 |
| InChI | InChI=1S/C10H8BrF2NO/c11-6-1-2-7(12)8(9(6)13)10(15)5-3-14-4-5/h1-2,5,14H,3-4H2 |
| InChIKey | SWCVNXCUERCBRO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|