C10H10BrClN2O — CID 81271143
N-(2-bromo-5-chlorophenyl)azetidine-3-carboxamide (PubChem CID 81271143) has the molecular formula C10H10BrClN2O and a molecular weight of 289.56 g/mol. Its IUPAC name is N-(2-bromo-5-chlorophenyl)azetidine-3-carboxamide.
| Compound Name | N-(2-bromo-5-chlorophenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 81271143 |
| Molecular Formula | C10H10BrClN2O |
| Molecular Weight | 289.56 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | N-(2-bromo-5-chlorophenyl)azetidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Br)C1CNC1 |
| InChI | InChI=1S/C10H10BrClN2O/c11-8-2-1-7(12)3-9(8)14-10(15)6-4-13-5-6/h1-3,6,13H,4-5H2,(H,14,15) |
| InChIKey | DUBORUMSZBOLDS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |