C11H11BrClNO — CID 81271769
N-(2-bromo-5-chlorophenyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 81271769) has the molecular formula C11H11BrClNO and a molecular weight of 288.57 g/mol. Its IUPAC name is N-(2-bromo-5-chlorophenyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(2-bromo-5-chlorophenyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 81271769 |
| Molecular Formula | C11H11BrClNO |
| Molecular Weight | 288.57 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | N-(2-bromo-5-chlorophenyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)Nc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C11H11BrClNO/c1-6-4-8(6)11(15)14-10-5-7(13)2-3-9(10)12/h2-3,5-6,8H,4H2,1H3,(H,14,15) |
| InChIKey | PBPZKUGGVUDHRJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |