C14H13BrClNO3 — CID 103775279
(1S,6R)-6-[(2-bromo-5-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 103775279) has the molecular formula C14H13BrClNO3 and a molecular weight of 358.62 g/mol. Its IUPAC name is (1S,6R)-6-[(2-bromo-5-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(2-bromo-5-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 103775279 |
| Molecular Formula | C14H13BrClNO3 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | (1S,6R)-6-[(2-bromo-5-chlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)Nc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H13BrClNO3/c15-11-6-5-8(16)7-12(11)17-13(18)9-3-1-2-4-10(9)14(19)20/h1-2,5-7,9-10H,3-4H2,(H,17,18)(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | UWQPRDLZAHDYOI-ZJUUUORDSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|