C14H12BrCl2NO3 — CID 104962097
(1S,6R)-6-[(4-bromo-2,6-dichlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962097) has the molecular formula C14H12BrCl2NO3 and a molecular weight of 393.06 g/mol. Its IUPAC name is (1S,6R)-6-[(4-bromo-2,6-dichlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(4-bromo-2,6-dichlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962097 |
| Molecular Formula | C14H12BrCl2NO3 |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | (1S,6R)-6-[(4-bromo-2,6-dichlorophenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C14H12BrCl2NO3/c15-7-5-10(16)12(11(17)6-7)18-13(19)8-3-1-2-4-9(8)14(20)21/h1-2,5-6,8-9H,3-4H2,(H,18,19)(H,20,21)/t8-,9+/m1/s1 |
| InChIKey | QZEIWLUONPRTCW-BDAKNGLRSA-N |
| XLogP | 4.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|