C14H13Cl3N2O3 — CID 40596714
(1S,6S)-6-[(2,4,6-trichloroanilino)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 40596714) has the molecular formula C14H13Cl3N2O3 and a molecular weight of 363.63 g/mol. Its IUPAC name is (1S,6S)-6-[(2,4,6-trichloroanilino)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(2,4,6-trichloroanilino)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40596714 |
| Molecular Formula | C14H13Cl3N2O3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | (1S,6S)-6-[(2,4,6-trichloroanilino)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@@H]1C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl3N2O3/c15-7-5-10(16)12(11(17)6-7)18-19-13(20)8-3-1-2-4-9(8)14(21)22/h1-2,5-6,8-9,18H,3-4H2,(H,19,20)(H,21,22)/t8-,9-/m0/s1 |
| InChIKey | LJSZSQVPHABSGJ-IUCAKERBSA-N |
| XLogP | 3.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|