C15H16BrF2NO — CID 106944089
2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromo-2,6-difluorophenyl)ethanone (PubChem CID 106944089) has the molecular formula C15H16BrF2NO and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromo-2,6-difluorophenyl)ethanone.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromo-2,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 106944089 |
| Molecular Formula | C15H16BrF2NO |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromo-2,6-difluorophenyl)ethanone |
| SMILES | O=C(CC1CC2CCC(C1)N2)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H16BrF2NO/c16-11-3-4-12(17)14(15(11)18)13(20)7-8-5-9-1-2-10(6-8)19-9/h3-4,8-10,19H,1-2,5-7H2 |
| InChIKey | IFSMEHHICAOONT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|