C15H18Br2N2O — CID 79606861
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2,5-dibromophenyl)acetamide (PubChem CID 79606861) has the molecular formula C15H18Br2N2O and a molecular weight of 402.13 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2,5-dibromophenyl)acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2,5-dibromophenyl)acetamide |
|---|---|
| PubChem CID | 79606861 |
| Molecular Formula | C15H18Br2N2O |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2,5-dibromophenyl)acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H18Br2N2O/c16-10-1-4-13(17)14(8-10)19-15(20)7-9-5-11-2-3-12(6-9)18-11/h1,4,8-9,11-12,18H,2-3,5-7H2,(H,19,20) |
| InChIKey | ZDQKECJSGDXGCS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |