C16H20F2O — CID 115794245
2-cycloheptyl-1-(2,6-difluoro-3-methylphenyl)ethanone (PubChem CID 115794245) has the molecular formula C16H20F2O and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-cycloheptyl-1-(2,6-difluoro-3-methylphenyl)ethanone.
| Compound Name | 2-cycloheptyl-1-(2,6-difluoro-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 115794245 |
| Molecular Formula | C16H20F2O |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-cycloheptyl-1-(2,6-difluoro-3-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)c(C(=O)CC2CCCCCC2)c1F |
| InChI | InChI=1S/C16H20F2O/c1-11-8-9-13(17)15(16(11)18)14(19)10-12-6-4-2-3-5-7-12/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | WAIZXNWFYKWBQW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |