C13H13BrF2O — CID 114969301
1-(4-bromo-2,6-difluorophenyl)-2-cyclopentylethanone (PubChem CID 114969301) has the molecular formula C13H13BrF2O and a molecular weight of 303.15 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-cyclopentylethanone.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-cyclopentylethanone |
|---|---|
| PubChem CID | 114969301 |
| Molecular Formula | C13H13BrF2O |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H13BrF2O/c14-9-6-10(15)13(11(16)7-9)12(17)5-8-3-1-2-4-8/h6-8H,1-5H2 |
| InChIKey | ABNVWGLFPDVKOI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |