C13H16OS2 — CID 79973595
(3,4-dimethylphenyl)-(1,4-dithian-2-yl)methanone (PubChem CID 79973595) has the molecular formula C13H16OS2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(1,4-dithian-2-yl)methanone.
| Compound Name | (3,4-dimethylphenyl)-(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 79973595 |
| Molecular Formula | C13H16OS2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (3,4-dimethylphenyl)-(1,4-dithian-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2CSCCS2)cc1C |
| InChI | InChI=1S/C13H16OS2/c1-9-3-4-11(7-10(9)2)13(14)12-8-15-5-6-16-12/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | IXYBOOHXOIALPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |