C15H20OS2 — CID 115386032
(3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 115386032) has the molecular formula C15H20OS2 and a molecular weight of 280.46 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115386032 |
| Molecular Formula | C15H20OS2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H20OS2/c1-4-13-15(18-8-7-17-13)14(16)12-6-5-10(2)11(3)9-12/h5-6,9,13,15H,4,7-8H2,1-3H3 |
| InChIKey | BTDBBPZFOZVOFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |