About (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone
(3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 115386032) has the molecular formula C15H20OS2
and a molecular weight of 280.46 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| PubChem CID | 115386032 |
| Molecular Formula | C15H20OS2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H20OS2/c1-4-13-15(18-8-7-17-13)14(16)12-6-5-10(2)11(3)9-12/h5-6,9,13,15H,4,7-8H2,1-3H3 |
| InChIKey | BTDBBPZFOZVOFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone?
The IUPAC name of (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone (CID 115386032) is (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone.
What is the SMILES notation for (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone?
The canonical SMILES for (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone is CCC1SCCSC1C(=O)c1ccc(C)c(C)c1.
What is the InChIKey of (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone?
The InChIKey is BTDBBPZFOZVOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20OS2/c1-4-13-15(18-8-7-17-13)14(16)12-6-5-10(2)11(3)9-12/h5-6,9,13,15H,4,7-8H2,1-3H3.
What are the key properties of (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone?
(3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone has a molecular weight of 280.46 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone is sourced from PubChem (CID 115386032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).