C16H22OS2 — CID 113299297
(3-ethyl-1,4-dithian-2-yl)-(2,4,5-trimethylphenyl)methanone (PubChem CID 113299297) has the molecular formula C16H22OS2 and a molecular weight of 294.49 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-(2,4,5-trimethylphenyl)methanone.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 113299297 |
| Molecular Formula | C16H22OS2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-(2,4,5-trimethylphenyl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C16H22OS2/c1-5-14-16(19-7-6-18-14)15(17)13-9-11(3)10(2)8-12(13)4/h8-9,14,16H,5-7H2,1-4H3 |
| InChIKey | WWINNWAYEWGAJO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |