C16H22O2S2 — CID 115386074
(3-ethyl-1,4-dithian-2-yl)-(4-propan-2-yloxyphenyl)methanone (PubChem CID 115386074) has the molecular formula C16H22O2S2 and a molecular weight of 310.48 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-(4-propan-2-yloxyphenyl)methanone.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-(4-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 115386074 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-(4-propan-2-yloxyphenyl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C16H22O2S2/c1-4-14-16(20-10-9-19-14)15(17)12-5-7-13(8-6-12)18-11(2)3/h5-8,11,14,16H,4,9-10H2,1-3H3 |
| InChIKey | AAYDJYPLDBIQII-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |