C14H18O2S2 — CID 79970623
1,4-dithian-2-yl-(4-propan-2-yloxyphenyl)methanone (PubChem CID 79970623) has the molecular formula C14H18O2S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(4-propan-2-yloxyphenyl)methanone.
| Compound Name | 1,4-dithian-2-yl-(4-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 79970623 |
| Molecular Formula | C14H18O2S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1,4-dithian-2-yl-(4-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(C(=O)C2CSCCS2)cc1 |
| InChI | InChI=1S/C14H18O2S2/c1-10(2)16-12-5-3-11(4-6-12)14(15)13-9-17-7-8-18-13/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | UUIACUJSQATBJC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |