C15H28OS2 — CID 115385863
1-(3-ethyl-1,4-dithian-2-yl)nonan-1-one (PubChem CID 115385863) has the molecular formula C15H28OS2 and a molecular weight of 288.52 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)nonan-1-one.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)nonan-1-one |
|---|---|
| PubChem CID | 115385863 |
| Molecular Formula | C15H28OS2 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)C1SCCSC1CC |
| InChI | InChI=1S/C15H28OS2/c1-3-5-6-7-8-9-10-13(16)15-14(4-2)17-11-12-18-15/h14-15H,3-12H2,1-2H3 |
| InChIKey | WWGZVBMVCCGYIJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|