C14H16BrFOS2 — CID 115385935
2-(3-bromo-4-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone (PubChem CID 115385935) has the molecular formula C14H16BrFOS2 and a molecular weight of 363.32 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 115385935 |
| Molecular Formula | C14H16BrFOS2 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CCC1SCCSC1C(=O)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H16BrFOS2/c1-2-13-14(19-6-5-18-13)12(17)8-9-3-4-11(16)10(15)7-9/h3-4,7,13-14H,2,5-6,8H2,1H3 |
| InChIKey | DRZJZZGBKQCKCG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |