C15H19BrFNO2 — CID 111434111
2-(3-bromo-4-fluorophenyl)-1-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone (PubChem CID 111434111) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 111434111 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone |
| SMILES | CC(O)C1CCN(C(=O)Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C15H19BrFNO2/c1-10(19)12-4-6-18(7-5-12)15(20)9-11-2-3-14(17)13(16)8-11/h2-3,8,10,12,19H,4-7,9H2,1H3 |
| InChIKey | HRZOXDCNEOJOQP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |