C14H18BrFN2O3S — CID 87021342
N-[1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-4-yl]methanesulfonamide (PubChem CID 87021342) has the molecular formula C14H18BrFN2O3S and a molecular weight of 393.28 g/mol. Its IUPAC name is N-[1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 87021342 |
| Molecular Formula | C14H18BrFN2O3S |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | N-[1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C14H18BrFN2O3S/c1-22(20,21)17-11-4-6-18(7-5-11)14(19)9-10-2-3-13(16)12(15)8-10/h2-3,8,11,17H,4-7,9H2,1H3 |
| InChIKey | VYABRFODDXHTCS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |