C14H18BrFN2O2 — CID 71939675
2-(3-bromo-4-fluorophenyl)-1-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone (PubChem CID 71939675) has the molecular formula C14H18BrFN2O2 and a molecular weight of 345.21 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 71939675 |
| Molecular Formula | C14H18BrFN2O2 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-[4-(2-hydroxyethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)c(Br)c1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H18BrFN2O2/c15-12-9-11(1-2-13(12)16)10-14(20)18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8,10H2 |
| InChIKey | YWOIFMYKCNQECB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |