C15H22N2O2S — CID 107226666
1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-(4-sulfanylphenyl)ethanone (PubChem CID 107226666) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-(4-sulfanylphenyl)ethanone.
| Compound Name | 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-(4-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 107226666 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2-(4-sulfanylphenyl)ethanone |
| SMILES | O=C(Cc1ccc(S)cc1)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C15H22N2O2S/c18-11-10-16-6-1-7-17(9-8-16)15(19)12-13-2-4-14(20)5-3-13/h2-5,18,20H,1,6-12H2 |
| InChIKey | UHOTWVHEFXJRDR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|