C14H19FN2O3S — CID 63212360
N-[1-(4-fluoro-3-methylbenzoyl)piperidin-4-yl]methanesulfonamide (PubChem CID 63212360) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[1-(4-fluoro-3-methylbenzoyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(4-fluoro-3-methylbenzoyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63212360 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[1-(4-fluoro-3-methylbenzoyl)piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1cc(C(=O)N2CCC(NS(C)(=O)=O)CC2)ccc1F |
| InChI | InChI=1S/C14H19FN2O3S/c1-10-9-11(3-4-13(10)15)14(18)17-7-5-12(6-8-17)16-21(2,19)20/h3-4,9,12,16H,5-8H2,1-2H3 |
| InChIKey | AUWHLDWXERKWDK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |