C13H18N2O5S — CID 108567177
N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]methanesulfonamide (PubChem CID 108567177) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 108567177 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C13H18N2O5S/c1-21(19,20)14-10-2-4-15(5-3-10)13(18)9-6-11(16)8-12(17)7-9/h6-8,10,14,16-17H,2-5H2,1H3 |
| InChIKey | YBRVNAFNQASVBM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |