C15H20BrFN2O — CID 119397501
2-(3-bromo-4-fluorophenyl)-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone (PubChem CID 119397501) has the molecular formula C15H20BrFN2O and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119397501 |
| Molecular Formula | C15H20BrFN2O |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-[3-(methylaminomethyl)piperidin-1-yl]ethanone |
| SMILES | CNCC1CCCN(C(=O)Cc2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C15H20BrFN2O/c1-18-9-12-3-2-6-19(10-12)15(20)8-11-4-5-14(17)13(16)7-11/h4-5,7,12,18H,2-3,6,8-10H2,1H3 |
| InChIKey | WWGNBQGYKAAGLZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |