C12H18N2OS2 — CID 115385881
(3-ethyl-1,4-dithian-2-yl)-(2-ethylpyrazol-3-yl)methanone (PubChem CID 115385881) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-(2-ethylpyrazol-3-yl)methanone.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-(2-ethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 115385881 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-(2-ethylpyrazol-3-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1ccnn1CC |
| InChI | InChI=1S/C12H18N2OS2/c1-3-10-12(17-8-7-16-10)11(15)9-5-6-13-14(9)4-2/h5-6,10,12H,3-4,7-8H2,1-2H3 |
| InChIKey | IPZJQEWDJGQMGH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |