C11H13BrOS3 — CID 115385889
(3-bromothiophen-2-yl)-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 115385889) has the molecular formula C11H13BrOS3 and a molecular weight of 337.33 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(3-ethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (3-bromothiophen-2-yl)-(3-ethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115385889 |
| Molecular Formula | C11H13BrOS3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | (3-bromothiophen-2-yl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1sccc1Br |
| InChI | InChI=1S/C11H13BrOS3/c1-2-8-11(16-6-5-14-8)9(13)10-7(12)3-4-15-10/h3-4,8,11H,2,5-6H2,1H3 |
| InChIKey | DLACLSGRYWIRLO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |