C13H20OS2 — CID 106652137
cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 106652137) has the molecular formula C13H20OS2 and a molecular weight of 256.44 g/mol. Its IUPAC name is cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methanone.
| Compound Name | cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 106652137 |
| Molecular Formula | C13H20OS2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C13H20OS2/c1-2-11-13(16-9-8-15-11)12(14)10-6-4-3-5-7-10/h6,11,13H,2-5,7-9H2,1H3 |
| InChIKey | MJMVTYQULISZHC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |