C9H9ClOS3 — CID 107359400
(3-chlorothiophen-2-yl)-(1,4-dithian-2-yl)methanone (PubChem CID 107359400) has the molecular formula C9H9ClOS3 and a molecular weight of 264.82 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(1,4-dithian-2-yl)methanone.
| Compound Name | (3-chlorothiophen-2-yl)-(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 107359400 |
| Molecular Formula | C9H9ClOS3 |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(1,4-dithian-2-yl)methanone |
| SMILES | O=C(c1sccc1Cl)C1CSCCS1 |
| InChI | InChI=1S/C9H9ClOS3/c10-6-1-2-14-9(6)8(11)7-5-12-3-4-13-7/h1-2,7H,3-5H2 |
| InChIKey | NABBLJNXNPYWIT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |