About 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone
2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone (PubChem CID 102651043) has the molecular formula C9H12O2S2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone |
| PubChem CID | 102651043 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone |
| SMILES | O=C(C1=CCCO1)C1CSCCS1 |
| InChI | InChI=1S/C9H12O2S2/c10-9(7-2-1-3-11-7)8-6-12-4-5-13-8/h2,8H,1,3-6H2 |
| InChIKey | USAKDMZBCUBQKR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone?
The IUPAC name of 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone (CID 102651043) is 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone.
What is the SMILES notation for 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone?
The canonical SMILES for 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone is O=C(C1=CCCO1)C1CSCCS1.
What is the InChIKey of 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone?
The InChIKey is USAKDMZBCUBQKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2S2/c10-9(7-2-1-3-11-7)8-6-12-4-5-13-8/h2,8H,1,3-6H2.
What are the key properties of 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone?
2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone has a molecular weight of 216.33 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone is sourced from PubChem (CID 102651043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).