C9H12O2S2 — CID 102651043
2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone (PubChem CID 102651043) has the molecular formula C9H12O2S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone.
| Compound Name | 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 102651043 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(1,4-dithian-2-yl)methanone |
| SMILES | O=C(C1=CCCO1)C1CSCCS1 |
| InChI | InChI=1S/C9H12O2S2/c10-9(7-2-1-3-11-7)8-6-12-4-5-13-8/h2,8H,1,3-6H2 |
| InChIKey | USAKDMZBCUBQKR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |