C5H9NO2S2 — CID 131102146
N-hydroxy-1,4-dithiane-2-carboxamide (PubChem CID 131102146) has the molecular formula C5H9NO2S2 and a molecular weight of 179.27 g/mol. Its IUPAC name is N-hydroxy-1,4-dithiane-2-carboxamide.
| Compound Name | N-hydroxy-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 131102146 |
| Molecular Formula | C5H9NO2S2 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | N-hydroxy-1,4-dithiane-2-carboxamide |
| SMILES | O=C(NO)C1CSCCS1 |
| InChI | InChI=1S/C5H9NO2S2/c7-5(6-8)4-3-9-1-2-10-4/h4,8H,1-3H2,(H,6,7) |
| InChIKey | MDHZVLKTLUTNIS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|