About N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride
N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride (PubChem CID 119524745) has the molecular formula C9H19ClN2OS2
and a molecular weight of 270.85 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride |
| PubChem CID | 119524745 |
| Molecular Formula | C9H19ClN2OS2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)C1CSCCS1.Cl |
| InChI | InChI=1S/C9H18N2OS2.ClH/c1-9(2,6-10)11-8(12)7-5-13-3-4-14-7;/h7H,3-6,10H2,1-2H3,(H,11,12);1H |
| InChIKey | VQBPCKPFKIWXPF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride?
The IUPAC name of N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride (CID 119524745) is N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride.
What is the SMILES notation for N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride?
The canonical SMILES for N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride is CC(C)(CN)NC(=O)C1CSCCS1.Cl.
What is the InChIKey of N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride?
The InChIKey is VQBPCKPFKIWXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2OS2.ClH/c1-9(2,6-10)11-8(12)7-5-13-3-4-14-7;/h7H,3-6,10H2,1-2H3,(H,11,12);1H.
What are the key properties of N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride?
N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride has a molecular weight of 270.85 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2-methylpropan-2-yl)-1,4-dithiane-2-carboxamide;hydrochloride is sourced from PubChem (CID 119524745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).