C14H26N2OS2 — CID 91645418
N-[2-(cycloheptylamino)ethyl]-1,4-dithiane-2-carboxamide (PubChem CID 91645418) has the molecular formula C14H26N2OS2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 91645418 |
| Molecular Formula | C14H26N2OS2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)C1CSCCS1 |
| InChI | InChI=1S/C14H26N2OS2/c17-14(13-11-18-9-10-19-13)16-8-7-15-12-5-3-1-2-4-6-12/h12-13,15H,1-11H2,(H,16,17) |
| InChIKey | XOZMQNVZTVGLDK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|