C13H11F6NOS2 — CID 86975714
N-[3,5-bis(trifluoromethyl)phenyl]-1,4-dithiane-2-carboxamide (PubChem CID 86975714) has the molecular formula C13H11F6NOS2 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 86975714 |
| Molecular Formula | C13H11F6NOS2 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CSCCS1 |
| InChI | InChI=1S/C13H11F6NOS2/c14-12(15,16)7-3-8(13(17,18)19)5-9(4-7)20-11(21)10-6-22-1-2-23-10/h3-5,10H,1-2,6H2,(H,20,21) |
| InChIKey | VGOKLTUITCYVJJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |