C16H13F6NO — CID 5092512
N-[3,5-bis(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 5092512) has the molecular formula C16H13F6NO and a molecular weight of 349.27 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 5092512 |
| Molecular Formula | C16H13F6NO |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H13F6NO/c17-15(18,19)10-5-11(16(20,21)22)7-12(6-10)23-14(24)13-4-8-1-2-9(13)3-8/h1-2,5-9,13H,3-4H2,(H,23,24) |
| InChIKey | RJVOPPZBHRWQHX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|