C15H17NO — CID 42906596
N-(4-methylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 42906596) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(4-methylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(4-methylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 42906596 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(4-methylphenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C15H17NO/c1-10-2-6-13(7-3-10)16-15(17)14-9-11-4-5-12(14)8-11/h2-7,11-12,14H,8-9H2,1H3,(H,16,17) |
| InChIKey | BJEOLASJGINHEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|