C16H20N2O3S — CID 99803971
(1S,2S,4S)-N-[4-(ethylsulfamoyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 99803971) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (1S,2S,4S)-N-[4-(ethylsulfamoyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-[4-(ethylsulfamoyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 99803971 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (1S,2S,4S)-N-[4-(ethylsulfamoyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=O)[C@H]2C[C@H]3C=C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-17-22(20,21)14-7-5-13(6-8-14)18-16(19)15-10-11-3-4-12(15)9-11/h3-8,11-12,15,17H,2,9-10H2,1H3,(H,18,19)/t11-,12+,15-/m0/s1 |
| InChIKey | QKVLBDTVSNTDJH-ZOWXZIJZSA-N |
| XLogP | 2.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|