C15H20N2O5S — CID 120974955
2-[[4-(propylsulfamoyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120974955) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[[4-(propylsulfamoyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[4-(propylsulfamoyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120974955 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[[4-(propylsulfamoyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)C2CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O5S/c1-2-9-16-23(21,22)11-5-3-10(4-6-11)17-14(18)12-7-8-13(12)15(19)20/h3-6,12-13,16H,2,7-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YKZWOVRCPQJOEN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |